C22H42O7S — CID 141479756
[(Z)-1,1-dihydroxy-3-methyl-4-oxohenicos-12-en-3-yl] hydrogen sulfate (PubChem CID 141479756) has the molecular formula C22H42O7S and a molecular weight of 450.64 g/mol. Its IUPAC name is [(Z)-1,1-dihydroxy-3-methyl-4-oxohenicos-12-en-3-yl] hydrogen sulfate.
| Compound Name | [(Z)-1,1-dihydroxy-3-methyl-4-oxohenicos-12-en-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 141479756 |
| Molecular Formula | C22H42O7S |
| Molecular Weight | 450.64 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | [(Z)-1,1-dihydroxy-3-methyl-4-oxohenicos-12-en-3-yl] hydrogen sulfate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(C)(CC(O)O)OS(=O)(=O)O |
| InChI | InChI=1S/C22H42O7S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(23)22(2,19-21(24)25)29-30(26,27)28/h10-11,21,24-25H,3-9,12-19H2,1-2H3,(H,26,27,28)/b11-10- |
| InChIKey | TZAUAUHNAZVUMY-KHPPLWFESA-N |
| XLogP | 4.87 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.64 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|