C29H48N2O11 — CID 88605791
[ethoxycarbonyl-[6-[ethoxycarbonyl(2-methylprop-2-enoyloxy)amino]-3,5,5-trimethylhexyl]amino] 2-methylprop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate (PubChem CID 88605791) has the molecular formula C29H48N2O11 and a molecular weight of 600.71 g/mol. Its IUPAC name is [ethoxycarbonyl-[6-[ethoxycarbonyl(2-methylprop-2-enoyloxy)amino]-3,5,5-trimethylhexyl]amino] 2-methylprop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate.
| Compound Name | [ethoxycarbonyl-[6-[ethoxycarbonyl(2-methylprop-2-enoyloxy)amino]-3,5,5-trimethylhexyl]amino] 2-methylprop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88605791 |
| Molecular Formula | C29H48N2O11 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | [ethoxycarbonyl-[6-[ethoxycarbonyl(2-methylprop-2-enoyloxy)amino]-3,5,5-trimethylhexyl]amino] 2-methylprop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCO.C=C(C)C(=O)ON(CCC(C)CC(C)(C)CN(OC(=O)C(=C)C)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C23H38N2O8.C6H10O3/c1-10-30-21(28)24(32-19(26)16(3)4)13-12-18(7)14-23(8,9)15-25(22(29)31-11-2)33-20(27)17(5)6;1-5(2)6(8)9-4-3-7/h18H,3,5,10-15H2,1-2,4,6-9H3;7H,1,3-4H2,2H3 |
| InChIKey | PYIHPLYPKRGJEI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 158.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|