C18H27F3O2 — CID 88632702
(8Z)-1-fluoro-2,2-bis(fluoromethyl)-9,13-dimethyltetradeca-8,12-diene-3,5-dione (PubChem CID 88632702) has the molecular formula C18H27F3O2 and a molecular weight of 332.41 g/mol. Its IUPAC name is (8Z)-1-fluoro-2,2-bis(fluoromethyl)-9,13-dimethyltetradeca-8,12-diene-3,5-dione.
| Compound Name | (8Z)-1-fluoro-2,2-bis(fluoromethyl)-9,13-dimethyltetradeca-8,12-diene-3,5-dione |
|---|---|
| PubChem CID | 88632702 |
| Molecular Formula | C18H27F3O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (8Z)-1-fluoro-2,2-bis(fluoromethyl)-9,13-dimethyltetradeca-8,12-diene-3,5-dione |
| SMILES | CC(C)=CCC/C(C)=C\CCC(=O)CC(=O)C(CF)(CF)CF |
| InChI | InChI=1S/C18H27F3O2/c1-14(2)6-4-7-15(3)8-5-9-16(22)10-17(23)18(11-19,12-20)13-21/h6,8H,4-5,7,9-13H2,1-3H3/b15-8- |
| InChIKey | MZCATYQTLVCCMO-NVNXTCNLSA-N |
| XLogP | 4.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|