C4H6BrN3O7 — CID 88642479
1-(2-bromoethoxy)-1,1,2-trinitroethane (PubChem CID 88642479) has the molecular formula C4H6BrN3O7 and a molecular weight of 288.01 g/mol. Its IUPAC name is 1-(2-bromoethoxy)-1,1,2-trinitroethane.
| Compound Name | 1-(2-bromoethoxy)-1,1,2-trinitroethane |
|---|---|
| PubChem CID | 88642479 |
| Molecular Formula | C4H6BrN3O7 |
| Molecular Weight | 288.01 g/mol |
| Exact Mass | 286.94 |
| IUPAC Name | 1-(2-bromoethoxy)-1,1,2-trinitroethane |
| SMILES | O=[N+]([O-])CC(OCCBr)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C4H6BrN3O7/c5-1-2-15-4(7(11)12,8(13)14)3-6(9)10/h1-3H2 |
| InChIKey | QWXOXZBBXGBKHP-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 138.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.01 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|