C22H30N4O5S — CID 88643833
8-amino-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-4,5-dihydro-3H-1,2-benzodioxepine-7-sulfonamide (PubChem CID 88643833) has the molecular formula C22H30N4O5S and a molecular weight of 462.57 g/mol. Its IUPAC name is 8-amino-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-4,5-dihydro-3H-1,2-benzodioxepine-7-sulfonamide.
| Compound Name | 8-amino-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-4,5-dihydro-3H-1,2-benzodioxepine-7-sulfonamide |
|---|---|
| PubChem CID | 88643833 |
| Molecular Formula | C22H30N4O5S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 8-amino-N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-4,5-dihydro-3H-1,2-benzodioxepine-7-sulfonamide |
| SMILES | COc1ccccc1N1CCN(CCNS(=O)(=O)c2cc3c(cc2N)OOCCC3)CC1 |
| InChI | InChI=1S/C22H30N4O5S/c1-29-20-7-3-2-6-19(20)26-12-10-25(11-13-26)9-8-24-32(27,28)22-15-17-5-4-14-30-31-21(17)16-18(22)23/h2-3,6-7,15-16,24H,4-5,8-14,23H2,1H3 |
| InChIKey | DBNVKXQODAQSHK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|