About (2-chloro-1H-indol-3-yl) formate
(2-chloro-1H-indol-3-yl) formate (PubChem CID 88648935) has the molecular formula C9H6ClNO2
and a molecular weight of 195.61 g/mol. Its IUPAC name is (2-chloro-1H-indol-3-yl) formate.
Molecular Properties
| Compound Name | (2-chloro-1H-indol-3-yl) formate |
| PubChem CID | 88648935 |
| Molecular Formula | C9H6ClNO2 |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | (2-chloro-1H-indol-3-yl) formate |
| SMILES | O=COc1c(Cl)[nH]c2ccccc12 |
| InChI | InChI=1S/C9H6ClNO2/c10-9-8(13-5-12)6-3-1-2-4-7(6)11-9/h1-5,11H |
| InChIKey | LYXUEZFKSWVFRT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-1H-indol-3-yl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-1H-indol-3-yl) formate?
The IUPAC name of (2-chloro-1H-indol-3-yl) formate (CID 88648935) is (2-chloro-1H-indol-3-yl) formate.
What is the SMILES notation for (2-chloro-1H-indol-3-yl) formate?
The canonical SMILES for (2-chloro-1H-indol-3-yl) formate is O=COc1c(Cl)[nH]c2ccccc12.
What is the InChIKey of (2-chloro-1H-indol-3-yl) formate?
The InChIKey is LYXUEZFKSWVFRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO2/c10-9-8(13-5-12)6-3-1-2-4-7(6)11-9/h1-5,11H.
What are the key properties of (2-chloro-1H-indol-3-yl) formate?
(2-chloro-1H-indol-3-yl) formate has a molecular weight of 195.61 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-1H-indol-3-yl) formate is sourced from PubChem (CID 88648935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).