C11H10ClF6NO3 — CID 88650490
2-[2-amino-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]acetic acid;hydrochloride (PubChem CID 88650490) has the molecular formula C11H10ClF6NO3 and a molecular weight of 353.65 g/mol. Its IUPAC name is 2-[2-amino-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]acetic acid;hydrochloride.
| Compound Name | 2-[2-amino-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 88650490 |
| Molecular Formula | C11H10ClF6NO3 |
| Molecular Weight | 353.65 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 2-[2-amino-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]acetic acid;hydrochloride |
| SMILES | Cl.Nc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1CC(=O)O |
| InChI | InChI=1S/C11H9F6NO3.ClH/c12-10(13,14)9(21,11(15,16)17)6-2-1-5(3-8(19)20)7(18)4-6;/h1-2,4,21H,3,18H2,(H,19,20);1H |
| InChIKey | HEXBIEBJNRPSPJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.65 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|