C17H18F6N4 — CID 150123604
5-[2-[3-amino-4-(aminomethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(aminomethyl)aniline (PubChem CID 150123604) has the molecular formula C17H18F6N4 and a molecular weight of 392.35 g/mol. Its IUPAC name is 5-[2-[3-amino-4-(aminomethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(aminomethyl)aniline.
| Compound Name | 5-[2-[3-amino-4-(aminomethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(aminomethyl)aniline |
|---|---|
| PubChem CID | 150123604 |
| Molecular Formula | C17H18F6N4 |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 5-[2-[3-amino-4-(aminomethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(aminomethyl)aniline |
| SMILES | NCc1ccc(C(c2ccc(CN)c(N)c2)(C(F)(F)F)C(F)(F)F)cc1N |
| InChI | InChI=1S/C17H18F6N4/c18-16(19,20)15(17(21,22)23,11-3-1-9(7-24)13(26)5-11)12-4-2-10(8-25)14(27)6-12/h1-6H,7-8,24-27H2 |
| InChIKey | DZTKYAWICIXMEV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|