About 2,6-dinitrofluoren-1-one
2,6-dinitrofluoren-1-one (PubChem CID 88650955) has the molecular formula C13H6N2O5
and a molecular weight of 270.20 g/mol. Its IUPAC name is 2,6-dinitrofluoren-1-one.
Molecular Properties
| Compound Name | 2,6-dinitrofluoren-1-one |
| PubChem CID | 88650955 |
| Molecular Formula | C13H6N2O5 |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 2,6-dinitrofluoren-1-one |
| SMILES | O=C1C2=Cc3ccc([N+](=O)[O-])cc3C2=CC=C1[N+](=O)[O-] |
| InChI | InChI=1S/C13H6N2O5/c16-13-11-5-7-1-2-8(14(17)18)6-10(7)9(11)3-4-12(13)15(19)20/h1-6H |
| InChIKey | LHMCXCYIXXAUBH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dinitrofluoren-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dinitrofluoren-1-one?
The IUPAC name of 2,6-dinitrofluoren-1-one (CID 88650955) is 2,6-dinitrofluoren-1-one.
What is the SMILES notation for 2,6-dinitrofluoren-1-one?
The canonical SMILES for 2,6-dinitrofluoren-1-one is O=C1C2=Cc3ccc([N+](=O)[O-])cc3C2=CC=C1[N+](=O)[O-].
What is the InChIKey of 2,6-dinitrofluoren-1-one?
The InChIKey is LHMCXCYIXXAUBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6N2O5/c16-13-11-5-7-1-2-8(14(17)18)6-10(7)9(11)3-4-12(13)15(19)20/h1-6H.
What are the key properties of 2,6-dinitrofluoren-1-one?
2,6-dinitrofluoren-1-one has a molecular weight of 270.20 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dinitrofluoren-1-one is sourced from PubChem (CID 88650955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).