C25H35ClO5 — CID 88665088
ethyl 5-[5-acetyloxy-6-(2-chloro-3-cyclopentyl-3-oxoprop-1-enyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate (PubChem CID 88665088) has the molecular formula C25H35ClO5 and a molecular weight of 451.00 g/mol. Its IUPAC name is ethyl 5-[5-acetyloxy-6-(2-chloro-3-cyclopentyl-3-oxoprop-1-enyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate.
| Compound Name | ethyl 5-[5-acetyloxy-6-(2-chloro-3-cyclopentyl-3-oxoprop-1-enyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate |
|---|---|
| PubChem CID | 88665088 |
| Molecular Formula | C25H35ClO5 |
| Molecular Weight | 451.00 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | ethyl 5-[5-acetyloxy-6-(2-chloro-3-cyclopentyl-3-oxoprop-1-enyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate |
| SMILES | CCOC(=O)CCCCC1=CC2CC(OC(C)=O)C(C=C(Cl)C(=O)C3CCCC3)C2C1 |
| InChI | InChI=1S/C25H35ClO5/c1-3-30-24(28)11-7-4-8-17-12-19-14-23(31-16(2)27)21(20(19)13-17)15-22(26)25(29)18-9-5-6-10-18/h12,15,18-21,23H,3-11,13-14H2,1-2H3 |
| InChIKey | DGGGGDXDUYJIAO-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.00 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|