C33H29NO7 — CID 88672841
prop-2-ynyl 2-benzamido-3-[3,4-bis(benzylperoxy)phenyl]propanoate (PubChem CID 88672841) has the molecular formula C33H29NO7 and a molecular weight of 551.60 g/mol. Its IUPAC name is prop-2-ynyl 2-benzamido-3-[3,4-bis(benzylperoxy)phenyl]propanoate.
| Compound Name | prop-2-ynyl 2-benzamido-3-[3,4-bis(benzylperoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 88672841 |
| Molecular Formula | C33H29NO7 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | prop-2-ynyl 2-benzamido-3-[3,4-bis(benzylperoxy)phenyl]propanoate |
| SMILES | C#CCOC(=O)C(Cc1ccc(OOCc2ccccc2)c(OOCc2ccccc2)c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H29NO7/c1-2-20-37-33(36)29(34-32(35)28-16-10-5-11-17-28)21-27-18-19-30(40-38-23-25-12-6-3-7-13-25)31(22-27)41-39-24-26-14-8-4-9-15-26/h1,3-19,22,29H,20-21,23-24H2,(H,34,35) |
| InChIKey | YTCNYAMPUHRQDB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|