C9H15NO4S — CID 88672876
(2R)-2-amino-3-(1-ethoxy-1-oxobut-3-en-2-yl)sulfanylpropanoic acid (PubChem CID 88672876) has the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. Its IUPAC name is (2R)-2-amino-3-(1-ethoxy-1-oxobut-3-en-2-yl)sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-(1-ethoxy-1-oxobut-3-en-2-yl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 88672876 |
| Molecular Formula | C9H15NO4S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | (2R)-2-amino-3-(1-ethoxy-1-oxobut-3-en-2-yl)sulfanylpropanoic acid |
| SMILES | C=CC(SC[C@H](N)C(=O)O)C(=O)OCC |
| InChI | InChI=1S/C9H15NO4S/c1-3-7(9(13)14-4-2)15-5-6(10)8(11)12/h3,6-7H,1,4-5,10H2,2H3,(H,11,12)/t6-,7?/m0/s1 |
| InChIKey | SLUDBTANTLHPLW-PKPIPKONSA-N |
| XLogP | 0.25 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|