C7H16N2O6S — CID 88674776
3-[bis(2-hydroxyethyl)amino]propanenitrile;sulfuric acid (PubChem CID 88674776) has the molecular formula C7H16N2O6S and a molecular weight of 256.28 g/mol. Its IUPAC name is 3-[bis(2-hydroxyethyl)amino]propanenitrile;sulfuric acid.
| Compound Name | 3-[bis(2-hydroxyethyl)amino]propanenitrile;sulfuric acid |
|---|---|
| PubChem CID | 88674776 |
| Molecular Formula | C7H16N2O6S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3-[bis(2-hydroxyethyl)amino]propanenitrile;sulfuric acid |
| SMILES | N#CCCN(CCO)CCO.O=S(=O)(O)O |
| InChI | InChI=1S/C7H14N2O2.H2O4S/c8-2-1-3-9(4-6-10)5-7-11;1-5(2,3)4/h10-11H,1,3-7H2;(H2,1,2,3,4) |
| InChIKey | GTSYWIAGBYUSOS-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 142.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|