C19H14O8 — CID 88674867
4-phenyl-6-prop-2-enoxycarbonylbenzene-1,2,3-tricarboxylic acid (PubChem CID 88674867) has the molecular formula C19H14O8 and a molecular weight of 370.31 g/mol. Its IUPAC name is 4-phenyl-6-prop-2-enoxycarbonylbenzene-1,2,3-tricarboxylic acid.
| Compound Name | 4-phenyl-6-prop-2-enoxycarbonylbenzene-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 88674867 |
| Molecular Formula | C19H14O8 |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 4-phenyl-6-prop-2-enoxycarbonylbenzene-1,2,3-tricarboxylic acid |
| SMILES | C=CCOC(=O)c1cc(-c2ccccc2)c(C(=O)O)c(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C19H14O8/c1-2-8-27-19(26)12-9-11(10-6-4-3-5-7-10)13(16(20)21)15(18(24)25)14(12)17(22)23/h2-7,9H,1,8H2,(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | HTWPFVOBZLCHKN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|