C24H30O10S3 — CID 88682209
2-hydroxyethyl 4-[4-hydroxy-3,5-bis[4-(2-hydroxyethoxy)-4-oxo-2-sulfanylidenebutyl]phenyl]-3-sulfanylidenebutanoate (PubChem CID 88682209) has the molecular formula C24H30O10S3 and a molecular weight of 574.70 g/mol. Its IUPAC name is 2-hydroxyethyl 4-[4-hydroxy-3,5-bis[4-(2-hydroxyethoxy)-4-oxo-2-sulfanylidenebutyl]phenyl]-3-sulfanylidenebutanoate.
| Compound Name | 2-hydroxyethyl 4-[4-hydroxy-3,5-bis[4-(2-hydroxyethoxy)-4-oxo-2-sulfanylidenebutyl]phenyl]-3-sulfanylidenebutanoate |
|---|---|
| PubChem CID | 88682209 |
| Molecular Formula | C24H30O10S3 |
| Molecular Weight | 574.70 g/mol |
| Exact Mass | 574.10 |
| IUPAC Name | 2-hydroxyethyl 4-[4-hydroxy-3,5-bis[4-(2-hydroxyethoxy)-4-oxo-2-sulfanylidenebutyl]phenyl]-3-sulfanylidenebutanoate |
| SMILES | O=C(CC(=S)Cc1cc(CC(=S)CC(=O)OCCO)c(O)c(CC(=S)CC(=O)OCCO)c1)OCCO |
| InChI | InChI=1S/C24H30O10S3/c25-1-4-32-21(28)12-18(35)9-15-7-16(10-19(36)13-22(29)33-5-2-26)24(31)17(8-15)11-20(37)14-23(30)34-6-3-27/h7-8,25-27,31H,1-6,9-14H2 |
| InChIKey | XHGIDJGTJKCWAZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.70 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|