C17H26O4 — CID 54207072
2-hydroxyethyl 2-[3-ethyl-4-hydroxy-5-(2-methylbutan-2-yl)phenyl]acetate (PubChem CID 54207072) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-hydroxyethyl 2-[3-ethyl-4-hydroxy-5-(2-methylbutan-2-yl)phenyl]acetate.
| Compound Name | 2-hydroxyethyl 2-[3-ethyl-4-hydroxy-5-(2-methylbutan-2-yl)phenyl]acetate |
|---|---|
| PubChem CID | 54207072 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 2-hydroxyethyl 2-[3-ethyl-4-hydroxy-5-(2-methylbutan-2-yl)phenyl]acetate |
| SMILES | CCc1cc(CC(=O)OCCO)cc(C(C)(C)CC)c1O |
| InChI | InChI=1S/C17H26O4/c1-5-13-9-12(11-15(19)21-8-7-18)10-14(16(13)20)17(3,4)6-2/h9-10,18,20H,5-8,11H2,1-4H3 |
| InChIKey | PTFWGZSKOHOJCA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |