C22H33NO — CID 88691816
(8Z,14Z)-docosa-8,14-dien-5,11-diynamide (PubChem CID 88691816) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is (8Z,14Z)-docosa-8,14-dien-5,11-diynamide.
| Compound Name | (8Z,14Z)-docosa-8,14-dien-5,11-diynamide |
|---|---|
| PubChem CID | 88691816 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | (8Z,14Z)-docosa-8,14-dien-5,11-diynamide |
| SMILES | CCCCCCC/C=C\CC#CC/C=C\CC#CCCCC(N)=O |
| InChI | InChI=1S/C22H33NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h8-9,14-15H,2-7,10,13,16,19-21H2,1H3,(H2,23,24)/b9-8-,15-14- |
| InChIKey | MZMQJXKNGUDEMV-FMUMETBJSA-N |
| XLogP | 5.29 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|