About 3a,6a-dihydro-[1,3]dithiolo[4,5-d][1,3]dioxole
3a,6a-dihydro-[1,3]dithiolo[4,5-d][1,3]dioxole (PubChem CID 88693550) has the molecular formula C4H6O2S2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 3a,6a-dihydro-[1,3]dithiolo[4,5-d][1,3]dioxole.
Analyze 3a,6a-dihydro-[1,3]dithiolo[4,5-d][1,3]dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,6a-dihydro-[1,3]dithiolo[4,5-d][1,3]dioxole?
The IUPAC name of 3a,6a-dihydro-[1,3]dithiolo[4,5-d][1,3]dioxole (CID 88693550) is 3a,6a-dihydro-[1,3]dithiolo[4,5-d][1,3]dioxole.
What is the SMILES notation for 3a,6a-dihydro-[1,3]dithiolo[4,5-d][1,3]dioxole?
The canonical SMILES for 3a,6a-dihydro-[1,3]dithiolo[4,5-d][1,3]dioxole is C1OC2SCSC2O1.
What is the InChIKey of 3a,6a-dihydro-[1,3]dithiolo[4,5-d][1,3]dioxole?
The InChIKey is SWSXRAZJZDLJKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2S2/c1-5-3-4(6-1)8-2-7-3/h3-4H,1-2H2.
What are the key properties of 3a,6a-dihydro-[1,3]dithiolo[4,5-d][1,3]dioxole?
3a,6a-dihydro-[1,3]dithiolo[4,5-d][1,3]dioxole has a molecular weight of 150.22 g/mol, XLogP of 1.08, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,6a-dihydro-[1,3]dithiolo[4,5-d][1,3]dioxole is sourced from PubChem (CID 88693550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).