C10H19NO9S — CID 88703987
(3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxy-N-prop-2-enylsulfonylheptanamide (PubChem CID 88703987) has the molecular formula C10H19NO9S and a molecular weight of 329.33 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxy-N-prop-2-enylsulfonylheptanamide.
| Compound Name | (3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxy-N-prop-2-enylsulfonylheptanamide |
|---|---|
| PubChem CID | 88703987 |
| Molecular Formula | C10H19NO9S |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | (3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxy-N-prop-2-enylsulfonylheptanamide |
| SMILES | C=CCS(=O)(=O)NC(=O)C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H19NO9S/c1-2-3-21(19,20)11-10(18)9(17)8(16)7(15)6(14)5(13)4-12/h2,5-9,12-17H,1,3-4H2,(H,11,18)/t5-,6-,7+,8-,9?/m1/s1 |
| InChIKey | VLXMZRTYTSMQEQ-LOFWALOHSA-N |
| XLogP | -4.58 |
| TPSA | 184.62 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | -4.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|