C12H17F3N4O3S — CID 88726035
methyl 5-[3-[sulfanyl(2,2,2-trifluoroethylcarbamoyl)amino]pyrazol-1-yl]pentanoate (PubChem CID 88726035) has the molecular formula C12H17F3N4O3S and a molecular weight of 354.35 g/mol. Its IUPAC name is methyl 5-[3-[sulfanyl(2,2,2-trifluoroethylcarbamoyl)amino]pyrazol-1-yl]pentanoate.
| Compound Name | methyl 5-[3-[sulfanyl(2,2,2-trifluoroethylcarbamoyl)amino]pyrazol-1-yl]pentanoate |
|---|---|
| PubChem CID | 88726035 |
| Molecular Formula | C12H17F3N4O3S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | methyl 5-[3-[sulfanyl(2,2,2-trifluoroethylcarbamoyl)amino]pyrazol-1-yl]pentanoate |
| SMILES | COC(=O)CCCCn1ccc(N(S)C(=O)NCC(F)(F)F)n1 |
| InChI | InChI=1S/C12H17F3N4O3S/c1-22-10(20)4-2-3-6-18-7-5-9(17-18)19(23)11(21)16-8-12(13,14)15/h5,7,23H,2-4,6,8H2,1H3,(H,16,21) |
| InChIKey | LSOKISCNNPLGHB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|