C23H28N2O8 — CID 88735245
2-(oxiran-2-ylmethoxy)-1-N,1-N,3-N,3-N-tetrakis(oxiran-2-ylmethyl)benzene-1,3-dicarboxamide (PubChem CID 88735245) has the molecular formula C23H28N2O8 and a molecular weight of 460.48 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxy)-1-N,1-N,3-N,3-N-tetrakis(oxiran-2-ylmethyl)benzene-1,3-dicarboxamide.
| Compound Name | 2-(oxiran-2-ylmethoxy)-1-N,1-N,3-N,3-N-tetrakis(oxiran-2-ylmethyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 88735245 |
| Molecular Formula | C23H28N2O8 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 2-(oxiran-2-ylmethoxy)-1-N,1-N,3-N,3-N-tetrakis(oxiran-2-ylmethyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(c1cccc(C(=O)N(CC2CO2)CC2CO2)c1OCC1CO1)N(CC1CO1)CC1CO1 |
| InChI | InChI=1S/C23H28N2O8/c26-22(24(4-14-8-28-14)5-15-9-29-15)19-2-1-3-20(21(19)33-13-18-12-32-18)23(27)25(6-16-10-30-16)7-17-11-31-17/h1-3,14-18H,4-13H2 |
| InChIKey | OHBXZGYOSHYXJI-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 112.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|