C25H29ClO4 — CID 88760311
[(8R,9S,10R,13S,14S,17R)-17-acetyl-12-chloro-10,13-dimethyl-1,2-dimethylidene-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 88760311) has the molecular formula C25H29ClO4 and a molecular weight of 428.96 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17R)-17-acetyl-12-chloro-10,13-dimethyl-1,2-dimethylidene-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8R,9S,10R,13S,14S,17R)-17-acetyl-12-chloro-10,13-dimethyl-1,2-dimethylidene-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 88760311 |
| Molecular Formula | C25H29ClO4 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17R)-17-acetyl-12-chloro-10,13-dimethyl-1,2-dimethylidene-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | C=C1C(=C)[C@@]2(C)C(=CC1=O)C=C[C@@H]1[C@@H]2CC(Cl)[C@@]2(C)[C@H]1CC[C@]2(OC(C)=O)C(C)=O |
| InChI | InChI=1S/C25H29ClO4/c1-13-14(2)23(5)17(11-21(13)29)7-8-18-19-9-10-25(15(3)27,30-16(4)28)24(19,6)22(26)12-20(18)23/h7-8,11,18-20,22H,1-2,9-10,12H2,3-6H3/t18-,19-,20-,22?,23-,24+,25-/m0/s1 |
| InChIKey | JYSGFAFVXXGAHA-QFRDHFMLSA-N |
| XLogP | 4.73 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|