C32H34O6 — CID 88762793
[(8S,9S,10R,13S,14S,17R)-17-acetyl-17-acetyloxy-10,13-dimethyl-1,2-dimethylidene-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-11-yl] benzoate (PubChem CID 88762793) has the molecular formula C32H34O6 and a molecular weight of 514.62 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17R)-17-acetyl-17-acetyloxy-10,13-dimethyl-1,2-dimethylidene-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-11-yl] benzoate.
| Compound Name | [(8S,9S,10R,13S,14S,17R)-17-acetyl-17-acetyloxy-10,13-dimethyl-1,2-dimethylidene-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-11-yl] benzoate |
|---|---|
| PubChem CID | 88762793 |
| Molecular Formula | C32H34O6 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17R)-17-acetyl-17-acetyloxy-10,13-dimethyl-1,2-dimethylidene-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-11-yl] benzoate |
| SMILES | C=C1C(=C)[C@@]2(C)C(=CC1=O)C=C[C@@H]1[C@@H]2C(OC(=O)c2ccccc2)C[C@@]2(C)[C@H]1CC[C@]2(OC(C)=O)C(C)=O |
| InChI | InChI=1S/C32H34O6/c1-18-19(2)31(6)23(16-26(18)35)12-13-24-25-14-15-32(20(3)33,38-21(4)34)30(25,5)17-27(28(24)31)37-29(36)22-10-8-7-9-11-22/h7-13,16,24-25,27-28H,1-2,14-15,17H2,3-6H3/t24-,25-,27?,28+,30-,31-,32-/m0/s1 |
| InChIKey | SMCWYAPDHUSUCA-GSZQQPRQSA-N |
| XLogP | 5.35 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|