C24H16N4O4S — CID 88761174
3-(furan-2-yl)-21,24-dihydroporphyrin-5-sulfonic acid (PubChem CID 88761174) has the molecular formula C24H16N4O4S and a molecular weight of 456.48 g/mol. Its IUPAC name is 3-(furan-2-yl)-21,24-dihydroporphyrin-5-sulfonic acid.
| Compound Name | 3-(furan-2-yl)-21,24-dihydroporphyrin-5-sulfonic acid |
|---|---|
| PubChem CID | 88761174 |
| Molecular Formula | C24H16N4O4S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 3-(furan-2-yl)-21,24-dihydroporphyrin-5-sulfonic acid |
| SMILES | O=S(=O)(O)c1c2nc(cc3nc(cc4ccc(cc5cc(-c6ccco6)c1[nH]5)[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C24H16N4O4S/c29-33(30,31)24-21-8-7-18(27-21)11-16-4-3-14(25-16)10-15-5-6-17(26-15)12-19-13-20(23(24)28-19)22-2-1-9-32-22/h1-13,26,28H,(H,29,30,31)/b14-10-,15-10-,16-11-,17-12-,18-11-,19-12-,24-21+,24-23+ |
| InChIKey | CKSDHYQESRFLGT-BHXFGGCASA-N |
| XLogP | 5.16 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|