C20H17N3O4S — CID 88771520
N-(2-hydroxy-2-phenylethyl)-4-oxo-2-sulfanylidene-1,5-dihydrochromeno[2,3-d]pyrimidine-7-carboxamide (PubChem CID 88771520) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is N-(2-hydroxy-2-phenylethyl)-4-oxo-2-sulfanylidene-1,5-dihydrochromeno[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | N-(2-hydroxy-2-phenylethyl)-4-oxo-2-sulfanylidene-1,5-dihydrochromeno[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 88771520 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | N-(2-hydroxy-2-phenylethyl)-4-oxo-2-sulfanylidene-1,5-dihydrochromeno[2,3-d]pyrimidine-7-carboxamide |
| SMILES | O=C(NCC(O)c1ccccc1)c1ccc2c(c1)Cc1c([nH]c(=S)[nH]c1=O)O2 |
| InChI | InChI=1S/C20H17N3O4S/c24-15(11-4-2-1-3-5-11)10-21-17(25)12-6-7-16-13(8-12)9-14-18(26)22-20(28)23-19(14)27-16/h1-8,15,24H,9-10H2,(H,21,25)(H2,22,23,26,28) |
| InChIKey | JEJCAXQJYJSPNV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|