C17H28NO2S+ — CID 88781269
[2,5-dimethyl-4-(pentylcarbamoyloxy)phenyl]-ethyl-methylsulfanium (PubChem CID 88781269) has the molecular formula C17H28NO2S+ and a molecular weight of 310.48 g/mol. Its IUPAC name is [2,5-dimethyl-4-(pentylcarbamoyloxy)phenyl]-ethyl-methylsulfanium.
| Compound Name | [2,5-dimethyl-4-(pentylcarbamoyloxy)phenyl]-ethyl-methylsulfanium |
|---|---|
| PubChem CID | 88781269 |
| Molecular Formula | C17H28NO2S+ |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | [2,5-dimethyl-4-(pentylcarbamoyloxy)phenyl]-ethyl-methylsulfanium |
| SMILES | CCCCCNC(=O)Oc1cc(C)c([S+](C)CC)cc1C |
| InChI | InChI=1S/C17H27NO2S/c1-6-8-9-10-18-17(19)20-15-11-14(4)16(12-13(15)3)21(5)7-2/h11-12H,6-10H2,1-5H3/p+1 |
| InChIKey | IZQWEYRYWRVPHN-UHFFFAOYSA-O |
| XLogP | 4.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|