C22H30N2O7S2 — CID 88783637
[[2,5-dimethyl-4-(pentylcarbamoyloxy)phenyl]-dimethyl-λ4-sulfanyl] 4-nitrobenzenesulfonate (PubChem CID 88783637) has the molecular formula C22H30N2O7S2 and a molecular weight of 498.62 g/mol. Its IUPAC name is [[2,5-dimethyl-4-(pentylcarbamoyloxy)phenyl]-dimethyl-λ4-sulfanyl] 4-nitrobenzenesulfonate.
| Compound Name | [[2,5-dimethyl-4-(pentylcarbamoyloxy)phenyl]-dimethyl-λ4-sulfanyl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 88783637 |
| Molecular Formula | C22H30N2O7S2 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | [[2,5-dimethyl-4-(pentylcarbamoyloxy)phenyl]-dimethyl-λ4-sulfanyl] 4-nitrobenzenesulfonate |
| SMILES | CCCCCNC(=O)Oc1cc(C)c(S(C)(C)OS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1C |
| InChI | InChI=1S/C22H30N2O7S2/c1-6-7-8-13-23-22(25)30-20-14-17(3)21(15-16(20)2)32(4,5)31-33(28,29)19-11-9-18(10-12-19)24(26)27/h9-12,14-15H,6-8,13H2,1-5H3,(H,23,25) |
| InChIKey | ZJDMGSNZORGCFW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|