About dibenzylphosphanide;rubidium(1+)
dibenzylphosphanide;rubidium(1+) (PubChem CID 88781491) has the molecular formula C14H14PRb
and a molecular weight of 298.71 g/mol. Its IUPAC name is dibenzylphosphanide;rubidium(1+).
Molecular Properties
| Compound Name | dibenzylphosphanide;rubidium(1+) |
| PubChem CID | 88781491 |
| Molecular Formula | C14H14PRb |
| Molecular Weight | 298.71 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | dibenzylphosphanide;rubidium(1+) |
| SMILES | [Rb+].c1ccc(C[P-]Cc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14P.Rb/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;/h1-10H,11-12H2;/q-1;+1 |
| InChIKey | HQLDMIGJBZVAIM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.71 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibenzylphosphanide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzylphosphanide;rubidium(1+)?
The IUPAC name of dibenzylphosphanide;rubidium(1+) (CID 88781491) is dibenzylphosphanide;rubidium(1+).
What is the SMILES notation for dibenzylphosphanide;rubidium(1+)?
The canonical SMILES for dibenzylphosphanide;rubidium(1+) is [Rb+].c1ccc(C[P-]Cc2ccccc2)cc1.
What is the InChIKey of dibenzylphosphanide;rubidium(1+)?
The InChIKey is HQLDMIGJBZVAIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14P.Rb/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;/h1-10H,11-12H2;/q-1;+1.
What are the key properties of dibenzylphosphanide;rubidium(1+)?
dibenzylphosphanide;rubidium(1+) has a molecular weight of 298.71 g/mol, XLogP of 1.34, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzylphosphanide;rubidium(1+) is sourced from PubChem (CID 88781491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).