About benzylsilane;hydron
benzylsilane;hydron (PubChem CID 175019637) has the molecular formula C7H12Si+2
and a molecular weight of 124.26 g/mol. Its IUPAC name is benzylsilane;hydron.
Molecular Properties
| Compound Name | benzylsilane;hydron |
| PubChem CID | 175019637 |
| Molecular Formula | C7H12Si+2 |
| Molecular Weight | 124.26 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | benzylsilane;hydron |
| SMILES | [H+].[H+].[SiH3]Cc1ccccc1 |
| InChI | InChI=1S/C7H10Si/c8-6-7-4-2-1-3-5-7/h1-5H,6H2,8H3/p+2 |
| InChIKey | UWAXDPWQPGZNIO-UHFFFAOYSA-P |
| XLogP | 0.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzylsilane;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylsilane;hydron?
The IUPAC name of benzylsilane;hydron (CID 175019637) is benzylsilane;hydron.
What is the SMILES notation for benzylsilane;hydron?
The canonical SMILES for benzylsilane;hydron is [H+].[H+].[SiH3]Cc1ccccc1.
What is the InChIKey of benzylsilane;hydron?
The InChIKey is UWAXDPWQPGZNIO-UHFFFAOYSA-P. The full InChI is InChI=1S/C7H10Si/c8-6-7-4-2-1-3-5-7/h1-5H,6H2,8H3/p+2.
What are the key properties of benzylsilane;hydron?
benzylsilane;hydron has a molecular weight of 124.26 g/mol, XLogP of 0.78, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzylsilane;hydron is sourced from PubChem (CID 175019637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).