C11H25Br2FN4O2 — CID 88794604
2-amino-N-[4-(2-aminopropanoylamino)-5-fluoropentyl]propanamide;dihydrobromide (PubChem CID 88794604) has the molecular formula C11H25Br2FN4O2 and a molecular weight of 424.15 g/mol. Its IUPAC name is 2-amino-N-[4-(2-aminopropanoylamino)-5-fluoropentyl]propanamide;dihydrobromide.
| Compound Name | 2-amino-N-[4-(2-aminopropanoylamino)-5-fluoropentyl]propanamide;dihydrobromide |
|---|---|
| PubChem CID | 88794604 |
| Molecular Formula | C11H25Br2FN4O2 |
| Molecular Weight | 424.15 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 2-amino-N-[4-(2-aminopropanoylamino)-5-fluoropentyl]propanamide;dihydrobromide |
| SMILES | Br.Br.CC(N)C(=O)NCCCC(CF)NC(=O)C(C)N |
| InChI | InChI=1S/C11H23FN4O2.2BrH/c1-7(13)10(17)15-5-3-4-9(6-12)16-11(18)8(2)14;;/h7-9H,3-6,13-14H2,1-2H3,(H,15,17)(H,16,18);2*1H |
| InChIKey | QKGWLMXIYZAYJL-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.15 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|