C10H12O7 — CID 88795509
2-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]oxypyran-2,3,4,5-tetrol (PubChem CID 88795509) has the molecular formula C10H12O7 and a molecular weight of 244.20 g/mol. Its IUPAC name is 2-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]oxypyran-2,3,4,5-tetrol.
| Compound Name | 2-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]oxypyran-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 88795509 |
| Molecular Formula | C10H12O7 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 2-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]oxypyran-2,3,4,5-tetrol |
| SMILES | OC1=COC(O)(O[C@H]2C=C[C@@H](O)C2)C(O)=C1O |
| InChI | InChI=1S/C10H12O7/c11-5-1-2-6(3-5)17-10(15)9(14)8(13)7(12)4-16-10/h1-2,4-6,11-15H,3H2/t5-,6+,10?/m1/s1 |
| InChIKey | DFFXZTAKYMWZCL-CGQSYLDTSA-N |
| XLogP | 0.10 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|