About 4-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]thiadiazole-5-carbaldehyde
4-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]thiadiazole-5-carbaldehyde (PubChem CID 88806136) has the molecular formula C17H19N7O3S
and a molecular weight of 401.45 g/mol. Its IUPAC name is 4-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]thiadiazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 4-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]thiadiazole-5-carbaldehyde |
| PubChem CID | 88806136 |
| Molecular Formula | C17H19N7O3S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 4-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]thiadiazole-5-carbaldehyde |
| SMILES | COc1cc2nc(N3CCN(c4nnsc4C=O)CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C17H19N7O3S/c1-26-12-7-10-11(8-13(12)27-2)19-17(20-15(10)18)24-5-3-23(4-6-24)16-14(9-25)28-22-21-16/h7-9H,3-6H2,1-2H3,(H2,18,19,20) |
| InChIKey | QLINRADFYTWLBA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]thiadiazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]thiadiazole-5-carbaldehyde?
The IUPAC name of 4-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]thiadiazole-5-carbaldehyde (CID 88806136) is 4-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]thiadiazole-5-carbaldehyde.
What is the SMILES notation for 4-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]thiadiazole-5-carbaldehyde?
The canonical SMILES for 4-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]thiadiazole-5-carbaldehyde is COc1cc2nc(N3CCN(c4nnsc4C=O)CC3)nc(N)c2cc1OC.
What is the InChIKey of 4-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]thiadiazole-5-carbaldehyde?
The InChIKey is QLINRADFYTWLBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N7O3S/c1-26-12-7-10-11(8-13(12)27-2)19-17(20-15(10)18)24-5-3-23(4-6-24)16-14(9-25)28-22-21-16/h7-9H,3-6H2,1-2H3,(H2,18,19,20).
What are the key properties of 4-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]thiadiazole-5-carbaldehyde?
4-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]thiadiazole-5-carbaldehyde has a molecular weight of 401.45 g/mol, XLogP of 1.22, 5 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]thiadiazole-5-carbaldehyde is sourced from PubChem (CID 88806136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).