C16H16N2O4S2 — CID 88834735
(carbamoyloxydisulfanyl) N,N-dibenzylcarbamate (PubChem CID 88834735) has the molecular formula C16H16N2O4S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is (carbamoyloxydisulfanyl) N,N-dibenzylcarbamate.
| Compound Name | (carbamoyloxydisulfanyl) N,N-dibenzylcarbamate |
|---|---|
| PubChem CID | 88834735 |
| Molecular Formula | C16H16N2O4S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | (carbamoyloxydisulfanyl) N,N-dibenzylcarbamate |
| SMILES | NC(=O)OSSOC(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C16H16N2O4S2/c17-15(19)21-23-24-22-16(20)18(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H2,17,19) |
| InChIKey | CORDMWHAAYDXLH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|