C21H26O2 — CID 88837038
(2E,4E,6E,8E,10Z)-4,8-dimethyl-10-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)deca-2,4,6,8-tetraenal (PubChem CID 88837038) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is (2E,4E,6E,8E,10Z)-4,8-dimethyl-10-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)deca-2,4,6,8-tetraenal.
| Compound Name | (2E,4E,6E,8E,10Z)-4,8-dimethyl-10-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)deca-2,4,6,8-tetraenal |
|---|---|
| PubChem CID | 88837038 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (2E,4E,6E,8E,10Z)-4,8-dimethyl-10-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)deca-2,4,6,8-tetraenal |
| SMILES | CC1=CC(=O)CC(C)(C)/C1=C/C=C(C)/C=C/C=C(C)/C=C/C=O |
| InChI | InChI=1S/C21H26O2/c1-16(10-7-13-22)8-6-9-17(2)11-12-20-18(3)14-19(23)15-21(20,4)5/h6-14H,15H2,1-5H3/b9-6+,10-7+,16-8+,17-11+,20-12+ |
| InChIKey | MOHFMUCRLOUSHZ-UKAYVMEPSA-N |
| XLogP | 5.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|