C37H40BrOP — CID 88837617
[3,7-dimethyl-1-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)octa-2,4,6-trienyl]-triphenylphosphanium bromide (PubChem CID 88837617) has the molecular formula C37H40BrOP and a molecular weight of 611.60 g/mol. Its IUPAC name is [3,7-dimethyl-1-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)octa-2,4,6-trienyl]-triphenylphosphanium bromide.
| Compound Name | [3,7-dimethyl-1-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)octa-2,4,6-trienyl]-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 88837617 |
| Molecular Formula | C37H40BrOP |
| Molecular Weight | 611.60 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | [3,7-dimethyl-1-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)octa-2,4,6-trienyl]-triphenylphosphanium bromide |
| SMILES | CC(C)=CC=CC(C)=CC(=C1C(C)=CC(=O)CC1(C)C)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C37H40OP.BrH/c1-28(2)17-16-18-29(3)25-35(36-30(4)26-31(38)27-37(36,5)6)39(32-19-10-7-11-20-32,33-21-12-8-13-22-33)34-23-14-9-15-24-34;/h7-26H,27H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | APZJRVYJYPDIBH-UHFFFAOYSA-M |
| XLogP | 5.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.60 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|