C15H12FNO — CID 888531
2,3-dihydro-1H-indol-7-yl-(3-fluorophenyl)methanone (PubChem CID 888531) has the molecular formula C15H12FNO and a molecular weight of 241.27 g/mol. Its IUPAC name is 2,3-dihydro-1H-indol-7-yl-(3-fluorophenyl)methanone.
| Compound Name | 2,3-dihydro-1H-indol-7-yl-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 888531 |
| Molecular Formula | C15H12FNO |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2,3-dihydro-1H-indol-7-yl-(3-fluorophenyl)methanone |
| SMILES | O=C(c1cccc(F)c1)c1cccc2c1NCC2 |
| InChI | InChI=1S/C15H12FNO/c16-12-5-1-4-11(9-12)15(18)13-6-2-3-10-7-8-17-14(10)13/h1-6,9,17H,7-8H2 |
| InChIKey | ZBYUEKNAJNMVAP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|