C34H53N — CID 88855686
2-[(E)-2,3-bis(ethenyl)-6-(4-methylcyclohexyl)hept-1-enyl]-1-cyclohex-3-en-1-yl-3-ethyl-2,3,3a,6,7,7a-hexahydroindole (PubChem CID 88855686) has the molecular formula C34H53N and a molecular weight of 475.81 g/mol. Its IUPAC name is 2-[(E)-2,3-bis(ethenyl)-6-(4-methylcyclohexyl)hept-1-enyl]-1-cyclohex-3-en-1-yl-3-ethyl-2,3,3a,6,7,7a-hexahydroindole.
| Compound Name | 2-[(E)-2,3-bis(ethenyl)-6-(4-methylcyclohexyl)hept-1-enyl]-1-cyclohex-3-en-1-yl-3-ethyl-2,3,3a,6,7,7a-hexahydroindole |
|---|---|
| PubChem CID | 88855686 |
| Molecular Formula | C34H53N |
| Molecular Weight | 475.81 g/mol |
| Exact Mass | 475.42 |
| IUPAC Name | 2-[(E)-2,3-bis(ethenyl)-6-(4-methylcyclohexyl)hept-1-enyl]-1-cyclohex-3-en-1-yl-3-ethyl-2,3,3a,6,7,7a-hexahydroindole |
| SMILES | C=C/C(=C\C1C(CC)C2C=CCCC2N1C1CC=CCC1)C(C=C)CCC(C)C1CCC(C)CC1 |
| InChI | InChI=1S/C34H53N/c1-6-27(23-20-26(5)29-21-18-25(4)19-22-29)28(7-2)24-34-31(8-3)32-16-12-13-17-33(32)35(34)30-14-10-9-11-15-30/h6-7,9-10,12,16,24-27,29-34H,1-2,8,11,13-15,17-23H2,3-5H3/b28-24+ |
| InChIKey | FNORGTGZGJJNGA-ZZIIXHQDSA-N |
| XLogP | 9.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.81 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|