C28H41N — CID 71235650
9-[4-[3-[(1S)-cyclohex-3-en-1-yl]propyl]cyclohexa-1,3-dien-1-yl]-1-methyl-1,2,3,4,4a,4b,5,6,8a,9a-decahydrocarbazole (PubChem CID 71235650) has the molecular formula C28H41N and a molecular weight of 391.64 g/mol. Its IUPAC name is 9-[4-[3-[(1S)-cyclohex-3-en-1-yl]propyl]cyclohexa-1,3-dien-1-yl]-1-methyl-1,2,3,4,4a,4b,5,6,8a,9a-decahydrocarbazole.
| Compound Name | 9-[4-[3-[(1S)-cyclohex-3-en-1-yl]propyl]cyclohexa-1,3-dien-1-yl]-1-methyl-1,2,3,4,4a,4b,5,6,8a,9a-decahydrocarbazole |
|---|---|
| PubChem CID | 71235650 |
| Molecular Formula | C28H41N |
| Molecular Weight | 391.64 g/mol |
| Exact Mass | 391.32 |
| IUPAC Name | 9-[4-[3-[(1S)-cyclohex-3-en-1-yl]propyl]cyclohexa-1,3-dien-1-yl]-1-methyl-1,2,3,4,4a,4b,5,6,8a,9a-decahydrocarbazole |
| SMILES | CC1CCCC2C3CCC=CC3N(C3=CC=C(CCC[C@@H]4CC=CCC4)CC3)C12 |
| InChI | InChI=1S/C28H41N/c1-21-9-7-15-26-25-14-5-6-16-27(25)29(28(21)26)24-19-17-23(18-20-24)13-8-12-22-10-3-2-4-11-22/h2-3,6,16-17,19,21-22,25-28H,4-5,7-15,18,20H2,1H3/t21?,22-,25?,26?,27?,28?/m1/s1 |
| InChIKey | HPTJBFDXAXJFGT-UOKWXSOPSA-N |
| XLogP | 7.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.64 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|