C22H18BCl2N3O2 — CID 88863341
CID 88863341 (PubChem CID 88863341) has the molecular formula C22H18BCl2N3O2 and a molecular weight of 438.12 g/mol.
| Compound Name | CID 88863341 |
|---|---|
| PubChem CID | 88863341 |
| Molecular Formula | C22H18BCl2N3O2 |
| Molecular Weight | 438.12 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2nc(N(C)c3c(Cl)cc(C(C)(C)O)cc3Cl)c3cc[nH]c(=O)c3c2c1 |
| InChI | InChI=1S/C22H18BCl2N3O2/c1-22(2,30)11-8-15(24)19(16(25)9-11)28(3)20-13-6-7-26-21(29)18(13)14-10-12(23)4-5-17(14)27-20/h4-10,30H,1-3H3,(H,26,29) |
| InChIKey | INMIEGIXKASCJL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.12 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|