C11H15F2NO6S — CID 88872559
(2,6-diacetyloxypiperidin-4-yl) 2,2-difluoro-2-sulfanylacetate (PubChem CID 88872559) has the molecular formula C11H15F2NO6S and a molecular weight of 327.31 g/mol. Its IUPAC name is (2,6-diacetyloxypiperidin-4-yl) 2,2-difluoro-2-sulfanylacetate.
| Compound Name | (2,6-diacetyloxypiperidin-4-yl) 2,2-difluoro-2-sulfanylacetate |
|---|---|
| PubChem CID | 88872559 |
| Molecular Formula | C11H15F2NO6S |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | (2,6-diacetyloxypiperidin-4-yl) 2,2-difluoro-2-sulfanylacetate |
| SMILES | CC(=O)OC1CC(OC(=O)C(F)(F)S)CC(OC(C)=O)N1 |
| InChI | InChI=1S/C11H15F2NO6S/c1-5(15)18-8-3-7(20-10(17)11(12,13)21)4-9(14-8)19-6(2)16/h7-9,14,21H,3-4H2,1-2H3 |
| InChIKey | ZAUCSZPWBXBSSV-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|