C33H39F3N4O6 — CID 88872753
1-[4-[4-(dihydroxyamino)-3-methoxyphenoxy]piperidin-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]propan-1-one (PubChem CID 88872753) has the molecular formula C33H39F3N4O6 and a molecular weight of 644.69 g/mol. Its IUPAC name is 1-[4-[4-(dihydroxyamino)-3-methoxyphenoxy]piperidin-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-[4-(dihydroxyamino)-3-methoxyphenoxy]piperidin-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 88872753 |
| Molecular Formula | C33H39F3N4O6 |
| Molecular Weight | 644.69 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | 1-[4-[4-(dihydroxyamino)-3-methoxyphenoxy]piperidin-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]propan-1-one |
| SMILES | COc1cc(OC2CCN(C(=O)CCN3CCN(c4ccc(OCc5ccc(C(F)(F)F)cc5)cc4)CC3)CC2)ccc1N(O)O |
| InChI | InChI=1S/C33H39F3N4O6/c1-44-31-22-29(10-11-30(31)40(42)43)46-28-12-16-39(17-13-28)32(41)14-15-37-18-20-38(21-19-37)26-6-8-27(9-7-26)45-23-24-2-4-25(5-3-24)33(34,35)36/h2-11,22,28,42-43H,12-21,23H2,1H3 |
| InChIKey | RVDFRLDXIDQCEH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.69 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|