C46H58O11S — CID 88880681
[(4R,5R,6R,7R)-7-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-[[(2S,3R,4R)-2,3-diethyl-4-[(4-methoxyphenyl)methoxy]cyclopentyl]methyl]-6-phenylmethoxy-1,3-dioxepan-5-yl] hydrogen sulfate (PubChem CID 88880681) has the molecular formula C46H58O11S and a molecular weight of 819.03 g/mol. Its IUPAC name is [(4R,5R,6R,7R)-7-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-[[(2S,3R,4R)-2,3-diethyl-4-[(4-methoxyphenyl)methoxy]cyclopentyl]methyl]-6-phenylmethoxy-1,3-dioxepan-5-yl] hydrogen sulfate.
| Compound Name | [(4R,5R,6R,7R)-7-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-[[(2S,3R,4R)-2,3-diethyl-4-[(4-methoxyphenyl)methoxy]cyclopentyl]methyl]-6-phenylmethoxy-1,3-dioxepan-5-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 88880681 |
| Molecular Formula | C46H58O11S |
| Molecular Weight | 819.03 g/mol |
| Exact Mass | 818.37 |
| IUPAC Name | [(4R,5R,6R,7R)-7-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-[[(2S,3R,4R)-2,3-diethyl-4-[(4-methoxyphenyl)methoxy]cyclopentyl]methyl]-6-phenylmethoxy-1,3-dioxepan-5-yl] hydrogen sulfate |
| SMILES | CC[C@H]1[C@H](OCc2ccc(OC)cc2)CC(C[C@H]2OCO[C@H]([C@@H](COCc3ccccc3)OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H]2OS(=O)(=O)O)[C@@H]1CC |
| InChI | InChI=1S/C46H58O11S/c1-4-39-37(25-41(40(39)5-2)52-29-36-21-23-38(50-3)24-22-36)26-42-45(57-58(47,48)49)46(54-30-35-19-13-8-14-20-35)44(56-32-55-42)43(53-28-34-17-11-7-12-18-34)31-51-27-33-15-9-6-10-16-33/h6-24,37,39-46H,4-5,25-32H2,1-3H3,(H,47,48,49)/t37?,39-,40+,41+,42+,43+,44+,45+,46-/m0/s1 |
| InChIKey | GPDXZHRAZRFNOA-YUKMGHCSSA-N |
| XLogP | 8.36 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.03 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|