C34H42O12S2 — CID 140606039
[(4S,5S,6R,7R)-7-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-6-phenylmethoxy-1,3-dioxepan-5-yl] sulfate (PubChem CID 140606039) has the molecular formula C34H42O12S2 and a molecular weight of 706.83 g/mol. Its IUPAC name is [(4S,5S,6R,7R)-7-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-6-phenylmethoxy-1,3-dioxepan-5-yl] sulfate.
| Compound Name | [(4S,5S,6R,7R)-7-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-6-phenylmethoxy-1,3-dioxepan-5-yl] sulfate |
|---|---|
| PubChem CID | 140606039 |
| Molecular Formula | C34H42O12S2 |
| Molecular Weight | 706.83 g/mol |
| Exact Mass | 706.21 |
| IUPAC Name | [(4S,5S,6R,7R)-7-[(1R)-1,2-bis(phenylmethoxy)ethyl]-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-6-phenylmethoxy-1,3-dioxepan-5-yl] sulfate |
| SMILES | O=S(=O)([O-])O[C@H]1[C@H](OCc2ccccc2)[C@@H]([C@@H](COCc2ccccc2)OCc2ccccc2)OCO[C@@H]1C[S+]1C[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C34H42O12S2/c35-16-30-31(37)27(36)21-47(30)22-29-33(46-48(38,39)40)34(43-19-26-14-8-3-9-15-26)32(45-23-44-29)28(42-18-25-12-6-2-7-13-25)20-41-17-24-10-4-1-5-11-24/h1-15,27-37H,16-23H2/t27-,28-,29-,30-,31+,32-,33-,34-,47?/m1/s1 |
| InChIKey | CTTRTEAWXJITOC-PAKWGCGUSA-N |
| XLogP | 1.68 |
| TPSA | 173.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.83 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|