C20H23F3N2O2 — CID 88890354
ethyl (2E)-2-[(Z)-2-aminoethenyl]-3-methyl-4-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]penta-2,4-dienoate (PubChem CID 88890354) has the molecular formula C20H23F3N2O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is ethyl (2E)-2-[(Z)-2-aminoethenyl]-3-methyl-4-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]penta-2,4-dienoate.
| Compound Name | ethyl (2E)-2-[(Z)-2-aminoethenyl]-3-methyl-4-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 88890354 |
| Molecular Formula | C20H23F3N2O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | ethyl (2E)-2-[(Z)-2-aminoethenyl]-3-methyl-4-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]penta-2,4-dienoate |
| SMILES | C=C(/C(C)=C(\C=C/N)C(=O)OCC)N1CCc2ccc(C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C20H23F3N2O2/c1-4-27-19(26)18(7-9-24)13(2)14(3)25-10-8-15-5-6-17(20(21,22)23)11-16(15)12-25/h5-7,9,11H,3-4,8,10,12,24H2,1-2H3/b9-7-,18-13+ |
| InChIKey | GTAFBDKZQVYSMR-FGQDEARFSA-N |
| XLogP | 3.93 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|