C14H18N4 — CID 88899559
2-[1-but-3-ynyl-3-(4-ethylpyrazol-1-yl)azetidin-3-yl]acetonitrile (PubChem CID 88899559) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is 2-[1-but-3-ynyl-3-(4-ethylpyrazol-1-yl)azetidin-3-yl]acetonitrile.
| Compound Name | 2-[1-but-3-ynyl-3-(4-ethylpyrazol-1-yl)azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 88899559 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2-[1-but-3-ynyl-3-(4-ethylpyrazol-1-yl)azetidin-3-yl]acetonitrile |
| SMILES | C#CCCN1CC(CC#N)(n2cc(CC)cn2)C1 |
| InChI | InChI=1S/C14H18N4/c1-3-5-8-17-11-14(12-17,6-7-15)18-10-13(4-2)9-16-18/h1,9-10H,4-6,8,11-12H2,2H3 |
| InChIKey | YQSNSQTXQGIMGF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|