C21H24F6NO+ — CID 88916249
[5-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]-2-methoxyphenyl]methyl-trimethylazanium (PubChem CID 88916249) has the molecular formula C21H24F6NO+ and a molecular weight of 420.42 g/mol. Its IUPAC name is [5-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]-2-methoxyphenyl]methyl-trimethylazanium.
| Compound Name | [5-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]-2-methoxyphenyl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 88916249 |
| Molecular Formula | C21H24F6NO+ |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | [5-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]-2-methoxyphenyl]methyl-trimethylazanium |
| SMILES | COc1ccc(C(c2ccc(C)cc2)(C(F)(F)F)C(F)(F)F)cc1C[N+](C)(C)C |
| InChI | InChI=1S/C21H24F6NO/c1-14-6-8-16(9-7-14)19(20(22,23)24,21(25,26)27)17-10-11-18(29-5)15(12-17)13-28(2,3)4/h6-12H,13H2,1-5H3/q+1 |
| InChIKey | UACRBLLWUYPFOR-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|