C20H15ClN2O3 — CID 88919573
2-[4-[(3-chloro-7-methoxyfuro[2,3-b]quinolin-4-yl)amino]phenyl]acetaldehyde (PubChem CID 88919573) has the molecular formula C20H15ClN2O3 and a molecular weight of 366.80 g/mol. Its IUPAC name is 2-[4-[(3-chloro-7-methoxyfuro[2,3-b]quinolin-4-yl)amino]phenyl]acetaldehyde.
| Compound Name | 2-[4-[(3-chloro-7-methoxyfuro[2,3-b]quinolin-4-yl)amino]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 88919573 |
| Molecular Formula | C20H15ClN2O3 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 2-[4-[(3-chloro-7-methoxyfuro[2,3-b]quinolin-4-yl)amino]phenyl]acetaldehyde |
| SMILES | COc1ccc2c(Nc3ccc(CC=O)cc3)c3c(Cl)coc3nc2c1 |
| InChI | InChI=1S/C20H15ClN2O3/c1-25-14-6-7-15-17(10-14)23-20-18(16(21)11-26-20)19(15)22-13-4-2-12(3-5-13)8-9-24/h2-7,9-11H,8H2,1H3,(H,22,23) |
| InChIKey | JTASCVYCZBXOBJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|