C14H11ClFN5OS — CID 88926787
N'-(3-chloro-4-fluorophenyl)-5-[2-(methylamino)-1,3-thiazol-4-yl]-1,2-oxazole-3-carboximidamide (PubChem CID 88926787) has the molecular formula C14H11ClFN5OS and a molecular weight of 351.79 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-5-[2-(methylamino)-1,3-thiazol-4-yl]-1,2-oxazole-3-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-5-[2-(methylamino)-1,3-thiazol-4-yl]-1,2-oxazole-3-carboximidamide |
|---|---|
| PubChem CID | 88926787 |
| Molecular Formula | C14H11ClFN5OS |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-5-[2-(methylamino)-1,3-thiazol-4-yl]-1,2-oxazole-3-carboximidamide |
| SMILES | CNc1nc(-c2cc(/C(N)=N/c3ccc(F)c(Cl)c3)no2)cs1 |
| InChI | InChI=1S/C14H11ClFN5OS/c1-18-14-20-11(6-23-14)12-5-10(21-22-12)13(17)19-7-2-3-9(16)8(15)4-7/h2-6H,1H3,(H2,17,19)(H,18,20) |
| InChIKey | UNHXWFNKRZFQEC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|