C14H17N5O4S2 — CID 88956297
2-[6-(2,3-dihydrothiophen-2-ylsulfonylamino)-3-azabicyclo[3.1.0]hexan-3-yl]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 88956297) has the molecular formula C14H17N5O4S2 and a molecular weight of 383.46 g/mol. Its IUPAC name is 2-[6-(2,3-dihydrothiophen-2-ylsulfonylamino)-3-azabicyclo[3.1.0]hexan-3-yl]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[6-(2,3-dihydrothiophen-2-ylsulfonylamino)-3-azabicyclo[3.1.0]hexan-3-yl]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 88956297 |
| Molecular Formula | C14H17N5O4S2 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 2-[6-(2,3-dihydrothiophen-2-ylsulfonylamino)-3-azabicyclo[3.1.0]hexan-3-yl]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2CC3C(C2)C3NS(=O)(=O)C2CC=CS2)nc1 |
| InChI | InChI=1S/C14H17N5O4S2/c20-13(17-21)8-4-15-14(16-5-8)19-6-9-10(7-19)12(9)18-25(22,23)11-2-1-3-24-11/h1,3-5,9-12,18,21H,2,6-7H2,(H,17,20) |
| InChIKey | SKQOJORMPKFKSF-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|