C9H6N2O5 — CID 88958245
(E)-3-(3-hydroxy-4,5-dinitrosophenyl)prop-2-enoic acid (PubChem CID 88958245) has the molecular formula C9H6N2O5 and a molecular weight of 222.16 g/mol. Its IUPAC name is (E)-3-(3-hydroxy-4,5-dinitrosophenyl)prop-2-enoic acid.
| Compound Name | (E)-3-(3-hydroxy-4,5-dinitrosophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 88958245 |
| Molecular Formula | C9H6N2O5 |
| Molecular Weight | 222.16 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | (E)-3-(3-hydroxy-4,5-dinitrosophenyl)prop-2-enoic acid |
| SMILES | O=Nc1cc(/C=C/C(=O)O)cc(O)c1N=O |
| InChI | InChI=1S/C9H6N2O5/c12-7-4-5(1-2-8(13)14)3-6(10-15)9(7)11-16/h1-4,12H,(H,13,14)/b2-1+ |
| InChIKey | HRLRKDVQKXVGBR-OWOJBTEDSA-N |
| XLogP | 2.29 |
| TPSA | 116.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|